| Product Numer: | RI177 |
| INCI Name: | Sodium Laureth Sulfate |
| Color: | White to yellowish |
| CAS Number: | 9004-82-4 |
| Shelf Life: | 24 months |
| Form: | Liquid |
| Flash Point: | >93 °C |
| Odor: | Characteristic |
| Solubility: | Yes |
| Grade Standard: | Industrial Grade |
| Purity (%): | 27% |
| Alternative Names: | Sodium lauryl ether sulfate, Sodium laureth sulphate, Sodium lauryl ether sulphate |
| Chemical Formula: | CH3(CH2)10CH2(OCH2CH2)nOSO3Na |
| IUPAC Name: | Sodium laureth sulfate |
| Molecular Weight: | 288.38 g/mol |
| Specific Gravity: | 1.05 |
| Boiling Point: | 100ºC |
| PH Level: | 6.5 - 7.5 |
| HLB Value: | 40 |
| Applications: | Creams, gels, foundations, lotions, sunscreen applications, conditioners, and different types of products that are emulsion based contain SLES. |
| Strength: | SLES 28% dissolves quickly in both hard and soft water and produces uniform foam. |